C13H15N5O3S — CID 125145430
methyl (5S)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 125145430) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is methyl (5S)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | methyl (5S)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 125145430 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | methyl (5S)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)C1=NO[C@H](CSc2nc3nc(C)cc(C)n3n2)C1 |
| InChI | InChI=1S/C13H15N5O3S/c1-7-4-8(2)18-12(14-7)15-13(16-18)22-6-9-5-10(17-21-9)11(19)20-3/h4,9H,5-6H2,1-3H3/t9-/m0/s1 |
| InChIKey | USTFYNKKYPDMGV-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 90.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |