C14H24N4O2 — CID 125145804
1-methyl-3-[2-(2-methylimidazol-1-yl)ethyl]-1-[[(2S)-oxan-2-yl]methyl]urea (PubChem CID 125145804) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-methyl-3-[2-(2-methylimidazol-1-yl)ethyl]-1-[[(2S)-oxan-2-yl]methyl]urea.
| Compound Name | 1-methyl-3-[2-(2-methylimidazol-1-yl)ethyl]-1-[[(2S)-oxan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 125145804 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-methyl-3-[2-(2-methylimidazol-1-yl)ethyl]-1-[[(2S)-oxan-2-yl]methyl]urea |
| SMILES | Cc1nccn1CCNC(=O)N(C)C[C@@H]1CCCCO1 |
| InChI | InChI=1S/C14H24N4O2/c1-12-15-6-8-18(12)9-7-16-14(19)17(2)11-13-5-3-4-10-20-13/h6,8,13H,3-5,7,9-11H2,1-2H3,(H,16,19)/t13-/m0/s1 |
| InChIKey | UNLSAFDOXVGTFU-ZDUSSCGKSA-N |
| XLogP | 1.40 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |