C14H18F2N2O2 — CID 125147439
(3S)-3-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyrrolidine-3-carboxamide (PubChem CID 125147439) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is (3S)-3-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-3-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 125147439 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (3S)-3-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpyrrolidine-3-carboxamide |
| SMILES | COc1ccc(CN(C)C(=O)[C@]2(F)CCNC2)cc1F |
| InChI | InChI=1S/C14H18F2N2O2/c1-18(13(19)14(16)5-6-17-9-14)8-10-3-4-12(20-2)11(15)7-10/h3-4,7,17H,5-6,8-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | ZJHPHGNIMUBDSN-AWEZNQCLSA-N |
| XLogP | 1.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |