C15H20N2O5S — CID 125148660
4-[[methyl-[(2S)-1-methylsulfonylpyrrolidine-2-carbonyl]amino]methyl]benzoic acid (PubChem CID 125148660) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[[methyl-[(2S)-1-methylsulfonylpyrrolidine-2-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[methyl-[(2S)-1-methylsulfonylpyrrolidine-2-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 125148660 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[[methyl-[(2S)-1-methylsulfonylpyrrolidine-2-carbonyl]amino]methyl]benzoic acid |
| SMILES | CN(Cc1ccc(C(=O)O)cc1)C(=O)[C@@H]1CCCN1S(C)(=O)=O |
| InChI | InChI=1S/C15H20N2O5S/c1-16(10-11-5-7-12(8-6-11)15(19)20)14(18)13-4-3-9-17(13)23(2,21)22/h5-8,13H,3-4,9-10H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | MDMNXJVZCRTPHO-ZDUSSCGKSA-N |
| XLogP | 0.77 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |