C15H20N2O5S — CID 56861416
N-[2-(4-hydroxyphenyl)-2-oxoethyl]-N-methyl-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 56861416) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)-2-oxoethyl]-N-methyl-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)-2-oxoethyl]-N-methyl-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56861416 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)-2-oxoethyl]-N-methyl-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CN(CC(=O)c1ccc(O)cc1)C(=O)C1CCCN1S(C)(=O)=O |
| InChI | InChI=1S/C15H20N2O5S/c1-16(10-14(19)11-5-7-12(18)8-6-11)15(20)13-4-3-9-17(13)23(2,21)22/h5-8,13,18H,3-4,9-10H2,1-2H3 |
| InChIKey | IGBAGWFEMJIANM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |