C15H16N2O4S — CID 125148794
(3R)-3-[[(2S)-2-(2-cyanophenoxy)propanoyl]amino]thiolane-3-carboxylic acid (PubChem CID 125148794) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is (3R)-3-[[(2S)-2-(2-cyanophenoxy)propanoyl]amino]thiolane-3-carboxylic acid.
| Compound Name | (3R)-3-[[(2S)-2-(2-cyanophenoxy)propanoyl]amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 125148794 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (3R)-3-[[(2S)-2-(2-cyanophenoxy)propanoyl]amino]thiolane-3-carboxylic acid |
| SMILES | C[C@H](Oc1ccccc1C#N)C(=O)N[C@@]1(C(=O)O)CCSC1 |
| InChI | InChI=1S/C15H16N2O4S/c1-10(21-12-5-3-2-4-11(12)8-16)13(18)17-15(14(19)20)6-7-22-9-15/h2-5,10H,6-7,9H2,1H3,(H,17,18)(H,19,20)/t10-,15-/m0/s1 |
| InChIKey | NSEIYRSFDCBYQD-BONVTDFDSA-N |
| XLogP | 1.40 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |