C18H22N2O5 — CID 125151991
3-[[(2R)-2-(2-cyanophenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid (PubChem CID 125151991) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[[(2R)-2-(2-cyanophenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[[(2R)-2-(2-cyanophenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 125151991 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[[(2R)-2-(2-cyanophenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid |
| SMILES | C[C@@H](Oc1ccccc1C#N)C(=O)N(CCC(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C18H22N2O5/c1-13(25-16-5-3-2-4-14(16)12-19)18(23)20(9-6-17(21)22)15-7-10-24-11-8-15/h2-5,13,15H,6-11H2,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | MLFUWPZGZAARKJ-CYBMUJFWSA-N |
| XLogP | 1.81 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |