C18H24ClNO5 — CID 125150239
3-[[(2R)-2-(4-chloro-3-methylphenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid (PubChem CID 125150239) has the molecular formula C18H24ClNO5 and a molecular weight of 369.85 g/mol. Its IUPAC name is 3-[[(2R)-2-(4-chloro-3-methylphenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[[(2R)-2-(4-chloro-3-methylphenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 125150239 |
| Molecular Formula | C18H24ClNO5 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-[[(2R)-2-(4-chloro-3-methylphenoxy)propanoyl]-(oxan-4-yl)amino]propanoic acid |
| SMILES | Cc1cc(O[C@H](C)C(=O)N(CCC(=O)O)C2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C18H24ClNO5/c1-12-11-15(3-4-16(12)19)25-13(2)18(23)20(8-5-17(21)22)14-6-9-24-10-7-14/h3-4,11,13-14H,5-10H2,1-2H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | CKCNWGVOXGUAFV-CYBMUJFWSA-N |
| XLogP | 2.90 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |