C16H19ClFNO5 — CID 125152341
2-[[(2R)-2-(2-chloro-4-fluorophenoxy)propanoyl]-(oxan-4-yl)amino]acetic acid (PubChem CID 125152341) has the molecular formula C16H19ClFNO5 and a molecular weight of 359.78 g/mol. Its IUPAC name is 2-[[(2R)-2-(2-chloro-4-fluorophenoxy)propanoyl]-(oxan-4-yl)amino]acetic acid.
| Compound Name | 2-[[(2R)-2-(2-chloro-4-fluorophenoxy)propanoyl]-(oxan-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 125152341 |
| Molecular Formula | C16H19ClFNO5 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[[(2R)-2-(2-chloro-4-fluorophenoxy)propanoyl]-(oxan-4-yl)amino]acetic acid |
| SMILES | C[C@@H](Oc1ccc(F)cc1Cl)C(=O)N(CC(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C16H19ClFNO5/c1-10(24-14-3-2-11(18)8-13(14)17)16(22)19(9-15(20)21)12-4-6-23-7-5-12/h2-3,8,10,12H,4-7,9H2,1H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | OCNRYWWPUKNNHW-SNVBAGLBSA-N |
| XLogP | 2.34 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |