C21H23ClF2N2O2 — CID 86944611
2-(2-chloro-4-fluorophenoxy)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylpropanamide (PubChem CID 86944611) has the molecular formula C21H23ClF2N2O2 and a molecular weight of 408.88 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylpropanamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 86944611 |
| Molecular Formula | C21H23ClF2N2O2 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylpropanamide |
| SMILES | CC(Oc1ccc(F)cc1Cl)C(=O)N(C)C1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H23ClF2N2O2/c1-14(28-20-8-5-16(24)13-19(20)22)21(27)25(2)17-9-11-26(12-10-17)18-6-3-15(23)4-7-18/h3-8,13-14,17H,9-12H2,1-2H3 |
| InChIKey | JLWLJDVAGYNKCD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |