C17H25ClN2O2 — CID 94638078
(2R)-2-(2-chloro-5-methylphenoxy)-N-methyl-N-(1-methylpiperidin-4-yl)propanamide (PubChem CID 94638078) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is (2R)-2-(2-chloro-5-methylphenoxy)-N-methyl-N-(1-methylpiperidin-4-yl)propanamide.
| Compound Name | (2R)-2-(2-chloro-5-methylphenoxy)-N-methyl-N-(1-methylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 94638078 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2R)-2-(2-chloro-5-methylphenoxy)-N-methyl-N-(1-methylpiperidin-4-yl)propanamide |
| SMILES | Cc1ccc(Cl)c(O[C@H](C)C(=O)N(C)C2CCN(C)CC2)c1 |
| InChI | InChI=1S/C17H25ClN2O2/c1-12-5-6-15(18)16(11-12)22-13(2)17(21)20(4)14-7-9-19(3)10-8-14/h5-6,11,13-14H,7-10H2,1-4H3/t13-/m1/s1 |
| InChIKey | ZAACMTJGIRMCHB-CYBMUJFWSA-N |
| XLogP | 2.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |