C17H21Cl2NO5 — CID 154750558
3-[3-(2,3-dichlorophenoxy)propanoyl-(oxan-4-yl)amino]propanoic acid (PubChem CID 154750558) has the molecular formula C17H21Cl2NO5 and a molecular weight of 390.26 g/mol. Its IUPAC name is 3-[3-(2,3-dichlorophenoxy)propanoyl-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[3-(2,3-dichlorophenoxy)propanoyl-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 154750558 |
| Molecular Formula | C17H21Cl2NO5 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-[3-(2,3-dichlorophenoxy)propanoyl-(oxan-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)CCOc1cccc(Cl)c1Cl)C1CCOCC1 |
| InChI | InChI=1S/C17H21Cl2NO5/c18-13-2-1-3-14(17(13)19)25-11-7-15(21)20(8-4-16(22)23)12-5-9-24-10-6-12/h1-3,12H,4-11H2,(H,22,23) |
| InChIKey | QBFBHEBDKMDVOV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |