C20H26N2O5 — CID 125152528
3-[[(2R)-oxolan-2-yl]methyl-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]propanoic acid (PubChem CID 125152528) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[[(2R)-oxolan-2-yl]methyl-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[(2R)-oxolan-2-yl]methyl-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 125152528 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-[[(2R)-oxolan-2-yl]methyl-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(C[C@H]1CCCO1)C(=O)c1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C20H26N2O5/c23-18-7-2-9-21(18)13-15-4-1-5-16(12-15)20(26)22(10-8-19(24)25)14-17-6-3-11-27-17/h1,4-5,12,17H,2-3,6-11,13-14H2,(H,24,25)/t17-/m1/s1 |
| InChIKey | PCMVIHYZDCDECW-QGZVFWFLSA-N |
| XLogP | 1.90 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |