C18H25NO6 — CID 125153162
2-methoxy-5-[[[(2R)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]methyl]benzoic acid (PubChem CID 125153162) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-methoxy-5-[[[(2R)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]methyl]benzoic acid.
| Compound Name | 2-methoxy-5-[[[(2R)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 125153162 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-methoxy-5-[[[(2R)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]methyl]benzoic acid |
| SMILES | COc1ccc(CNC(=O)[C@@H](C)OC[C@H]2CCCCO2)cc1C(=O)O |
| InChI | InChI=1S/C18H25NO6/c1-12(25-11-14-5-3-4-8-24-14)17(20)19-10-13-6-7-16(23-2)15(9-13)18(21)22/h6-7,9,12,14H,3-5,8,10-11H2,1-2H3,(H,19,20)(H,21,22)/t12-,14-/m1/s1 |
| InChIKey | SNDZXJXOEXLSTJ-TZMCWYRMSA-N |
| XLogP | 1.98 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |