C17H27NO3 — CID 43591754
N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]propan-2-amine (PubChem CID 43591754) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 43591754 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]propan-2-amine |
| SMILES | COc1cc(CNC(C)C)ccc1OCC1CCCCO1 |
| InChI | InChI=1S/C17H27NO3/c1-13(2)18-11-14-7-8-16(17(10-14)19-3)21-12-15-6-4-5-9-20-15/h7-8,10,13,15,18H,4-6,9,11-12H2,1-3H3 |
| InChIKey | FNRWZEMEFLYZQH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |