C14H13FN2O4 — CID 1251544
dimethyl 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate (PubChem CID 1251544) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is dimethyl 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate.
| Compound Name | dimethyl 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 1251544 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | dimethyl 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)n(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H13FN2O4/c1-20-13(18)11-7-12(14(19)21-2)17(16-11)8-9-3-5-10(15)6-4-9/h3-7H,8H2,1-2H3 |
| InChIKey | ZFUBRCWNGGBNSH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |