C9H19NO2 — CID 125154641
2-[(2S,6R)-2-ethyl-6-methylmorpholin-4-yl]ethanol (PubChem CID 125154641) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[(2S,6R)-2-ethyl-6-methylmorpholin-4-yl]ethanol.
| Compound Name | 2-[(2S,6R)-2-ethyl-6-methylmorpholin-4-yl]ethanol |
|---|---|
| PubChem CID | 125154641 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2-[(2S,6R)-2-ethyl-6-methylmorpholin-4-yl]ethanol |
| SMILES | CC[C@H]1CN(CCO)C[C@@H](C)O1 |
| InChI | InChI=1S/C9H19NO2/c1-3-9-7-10(4-5-11)6-8(2)12-9/h8-9,11H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | HINOAWRCOPOPER-BDAKNGLRSA-N |
| XLogP | 0.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |