C15H19ClN4O3 — CID 125154769
(2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]acetamide (PubChem CID 125154769) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]acetamide.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 125154769 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]acetamide |
| SMILES | COCCCn1cnnc1CNC(=O)[C@H](O)c1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN4O3/c1-23-8-4-7-20-10-18-19-13(20)9-17-15(22)14(21)11-5-2-3-6-12(11)16/h2-3,5-6,10,14,21H,4,7-9H2,1H3,(H,17,22)/t14-/m1/s1 |
| InChIKey | CHOZAOZXYKIHEZ-CQSZACIVSA-N |
| XLogP | 1.32 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|