C24H32N2O — CID 125156876
4-phenyl-1-[[4-[[(3R)-piperidin-3-yl]methoxy]phenyl]methyl]piperidine (PubChem CID 125156876) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 4-phenyl-1-[[4-[[(3R)-piperidin-3-yl]methoxy]phenyl]methyl]piperidine.
| Compound Name | 4-phenyl-1-[[4-[[(3R)-piperidin-3-yl]methoxy]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 125156876 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 4-phenyl-1-[[4-[[(3R)-piperidin-3-yl]methoxy]phenyl]methyl]piperidine |
| SMILES | c1ccc(C2CCN(Cc3ccc(OC[C@@H]4CCCNC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O/c1-2-6-22(7-3-1)23-12-15-26(16-13-23)18-20-8-10-24(11-9-20)27-19-21-5-4-14-25-17-21/h1-3,6-11,21,23,25H,4-5,12-19H2/t21-/m1/s1 |
| InChIKey | QXRQAIDAMFMOHM-OAQYLSRUSA-N |
| XLogP | 4.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |