C20H25N3O3 — CID 125157558
N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(2-oxo-1H-pyridin-3-yl)benzamide (PubChem CID 125157558) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(2-oxo-1H-pyridin-3-yl)benzamide.
| Compound Name | N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(2-oxo-1H-pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 125157558 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(2-oxo-1H-pyridin-3-yl)benzamide |
| SMILES | O=C(NCCN1CCCC[C@@H]1CO)c1cccc(-c2ccc[nH]c2=O)c1 |
| InChI | InChI=1S/C20H25N3O3/c24-14-17-7-1-2-11-23(17)12-10-22-19(25)16-6-3-5-15(13-16)18-8-4-9-21-20(18)26/h3-6,8-9,13,17,24H,1-2,7,10-12,14H2,(H,21,26)(H,22,25)/t17-/m1/s1 |
| InChIKey | HLRBIULCPRNSOK-QGZVFWFLSA-N |
| XLogP | 1.62 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |