C22H27FN2O2 — CID 126450240
3-(4-fluoro-2-methylphenyl)-N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]benzamide (PubChem CID 126450240) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-(4-fluoro-2-methylphenyl)-N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]benzamide.
| Compound Name | 3-(4-fluoro-2-methylphenyl)-N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126450240 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-(4-fluoro-2-methylphenyl)-N-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]benzamide |
| SMILES | Cc1cc(F)ccc1-c1cccc(C(=O)NCCN2CCCC[C@@H]2CO)c1 |
| InChI | InChI=1S/C22H27FN2O2/c1-16-13-19(23)8-9-21(16)17-5-4-6-18(14-17)22(27)24-10-12-25-11-3-2-7-20(25)15-26/h4-6,8-9,13-14,20,26H,2-3,7,10-12,15H2,1H3,(H,24,27)/t20-/m1/s1 |
| InChIKey | HWQCLQYCHDOEKK-HXUWFJFHSA-N |
| XLogP | 3.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |