C21H28N2O3 — CID 125158902
2-(3-acetyl-7-ethylindol-1-yl)-N-[2-[(3S)-oxan-3-yl]ethyl]acetamide (PubChem CID 125158902) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-(3-acetyl-7-ethylindol-1-yl)-N-[2-[(3S)-oxan-3-yl]ethyl]acetamide.
| Compound Name | 2-(3-acetyl-7-ethylindol-1-yl)-N-[2-[(3S)-oxan-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 125158902 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-(3-acetyl-7-ethylindol-1-yl)-N-[2-[(3S)-oxan-3-yl]ethyl]acetamide |
| SMILES | CCc1cccc2c(C(C)=O)cn(CC(=O)NCC[C@@H]3CCCOC3)c12 |
| InChI | InChI=1S/C21H28N2O3/c1-3-17-7-4-8-18-19(15(2)24)12-23(21(17)18)13-20(25)22-10-9-16-6-5-11-26-14-16/h4,7-8,12,16H,3,5-6,9-11,13-14H2,1-2H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | OBCSZDUIAAIQJY-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |