C20H27N5O2 — CID 125159632
1-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea (PubChem CID 125159632) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 125159632 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
| SMILES | Cn1ccnc1[C@@H](NC(=O)Nc1ccccc1CN1CCOCC1)C1CC1 |
| InChI | InChI=1S/C20H27N5O2/c1-24-9-8-21-19(24)18(15-6-7-15)23-20(26)22-17-5-3-2-4-16(17)14-25-10-12-27-13-11-25/h2-5,8-9,15,18H,6-7,10-14H2,1H3,(H2,22,23,26)/t18-/m0/s1 |
| InChIKey | ZLMUTMBWMUOKPE-SFHVURJKSA-N |
| XLogP | 2.53 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |