C12H17N7O — CID 125162292
1-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-(1-methyltriazol-4-yl)urea (PubChem CID 125162292) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-(1-methyltriazol-4-yl)urea.
| Compound Name | 1-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-(1-methyltriazol-4-yl)urea |
|---|---|
| PubChem CID | 125162292 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-3-(1-methyltriazol-4-yl)urea |
| SMILES | Cn1cc(NC(=O)N[C@@H](c2nccn2C)C2CC2)nn1 |
| InChI | InChI=1S/C12H17N7O/c1-18-6-5-13-11(18)10(8-3-4-8)15-12(20)14-9-7-19(2)17-16-9/h5-8,10H,3-4H2,1-2H3,(H2,14,15,20)/t10-/m1/s1 |
| InChIKey | KZTSPJYTDSRHQX-SNVBAGLBSA-N |
| XLogP | 0.82 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |