C16H21N3O2S — CID 125159919
2-ethylsulfanyl-N-[(1R)-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]acetamide (PubChem CID 125159919) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-[(1R)-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]acetamide.
| Compound Name | 2-ethylsulfanyl-N-[(1R)-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 125159919 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-ethylsulfanyl-N-[(1R)-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]acetamide |
| SMILES | CCSCC(=O)N[C@H](C)c1cnn(-c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-4-22-11-16(20)18-12(2)13-9-17-19(10-13)14-5-7-15(21-3)8-6-14/h5-10,12H,4,11H2,1-3H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | IZRCNUQDBCJYTL-GFCCVEGCSA-N |
| XLogP | 2.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |