C21H24N4O5 — CID 163341143
2-ethyl-N-[1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide;formic acid (PubChem CID 163341143) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-ethyl-N-[1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide;formic acid.
| Compound Name | 2-ethyl-N-[1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 163341143 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-ethyl-N-[1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide;formic acid |
| SMILES | CCc1[nH]c(=O)ccc1C(=O)NC(C)c1cnn(-c2ccc(OC)cc2)c1.O=CO |
| InChI | InChI=1S/C20H22N4O3.CH2O2/c1-4-18-17(9-10-19(25)23-18)20(26)22-13(2)14-11-21-24(12-14)15-5-7-16(27-3)8-6-15;2-1-3/h5-13H,4H2,1-3H3,(H,22,26)(H,23,25);1H,(H,2,3) |
| InChIKey | RZIDQPYZRXXCEZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|