C15H21N5O2 — CID 125160794
N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-6-[(3S)-oxolan-3-yl]pyrimidin-4-amine (PubChem CID 125160794) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-6-[(3S)-oxolan-3-yl]pyrimidin-4-amine.
| Compound Name | N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-6-[(3S)-oxolan-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 125160794 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]-6-[(3S)-oxolan-3-yl]pyrimidin-4-amine |
| SMILES | COCCn1cncc1CNc1cc([C@@H]2CCOC2)ncn1 |
| InChI | InChI=1S/C15H21N5O2/c1-21-5-3-20-11-16-7-13(20)8-17-15-6-14(18-10-19-15)12-2-4-22-9-12/h6-7,10-12H,2-5,8-9H2,1H3,(H,17,18,19)/t12-/m1/s1 |
| InChIKey | GQYNPNKJGSBVGM-GFCCVEGCSA-N |
| XLogP | 1.44 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |