C18H26N4O3 — CID 125163480
1-[[(3R)-3-hydroxypiperidin-3-yl]methyl]-3-[2-methyl-5-(2-oxopyrrolidin-1-yl)phenyl]urea (PubChem CID 125163480) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[[(3R)-3-hydroxypiperidin-3-yl]methyl]-3-[2-methyl-5-(2-oxopyrrolidin-1-yl)phenyl]urea.
| Compound Name | 1-[[(3R)-3-hydroxypiperidin-3-yl]methyl]-3-[2-methyl-5-(2-oxopyrrolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 125163480 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[[(3R)-3-hydroxypiperidin-3-yl]methyl]-3-[2-methyl-5-(2-oxopyrrolidin-1-yl)phenyl]urea |
| SMILES | Cc1ccc(N2CCCC2=O)cc1NC(=O)NC[C@@]1(O)CCCNC1 |
| InChI | InChI=1S/C18H26N4O3/c1-13-5-6-14(22-9-2-4-16(22)23)10-15(13)21-17(24)20-12-18(25)7-3-8-19-11-18/h5-6,10,19,25H,2-4,7-9,11-12H2,1H3,(H2,20,21,24)/t18-/m1/s1 |
| InChIKey | ULJMTJNNIRDGQB-GOSISDBHSA-N |
| XLogP | 1.36 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |