C25H34N2O4 — CID 125167895
2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[[(2S)-spiro[2.5]octan-2-yl]methyl]acetamide (PubChem CID 125167895) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[[(2S)-spiro[2.5]octan-2-yl]methyl]acetamide.
| Compound Name | 2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[[(2S)-spiro[2.5]octan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 125167895 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[[(2S)-spiro[2.5]octan-2-yl]methyl]acetamide |
| SMILES | COCCCN1C(=O)C[C@@](CC(=O)NC[C@H]2CC23CCCCC3)(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H34N2O4/c1-31-14-8-13-27-22(29)17-25(23(27)30,19-9-4-2-5-10-19)16-21(28)26-18-20-15-24(20)11-6-3-7-12-24/h2,4-5,9-10,20H,3,6-8,11-18H2,1H3,(H,26,28)/t20-,25+/m1/s1 |
| InChIKey | UKXLLFLYZWUNDA-NLFFAJNJSA-N |
| XLogP | 3.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|