C16H23ClN6O — CID 125169706
4-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine (PubChem CID 125169706) has the molecular formula C16H23ClN6O and a molecular weight of 350.85 g/mol. Its IUPAC name is 4-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 125169706 |
| Molecular Formula | C16H23ClN6O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine |
| SMILES | Cc1nn(CCCNc2cc([C@H]3CCOC3)nc(N)n2)c(C)c1Cl |
| InChI | InChI=1S/C16H23ClN6O/c1-10-15(17)11(2)23(22-10)6-3-5-19-14-8-13(20-16(18)21-14)12-4-7-24-9-12/h8,12H,3-7,9H2,1-2H3,(H3,18,19,20,21)/t12-/m0/s1 |
| InChIKey | MZPHMOKLYBTMKA-LBPRGKRZSA-N |
| XLogP | 2.53 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|