C20H23ClN2O2 — CID 125171601
2-(3-aminopropoxy)-4-chloro-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 125171601) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-4-chloro-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | 2-(3-aminopropoxy)-4-chloro-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 125171601 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(3-aminopropoxy)-4-chloro-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | NCCCOc1cc(Cl)ccc1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H23ClN2O2/c21-15-9-10-17(19(13-15)25-12-4-11-22)20(24)23-18-8-3-6-14-5-1-2-7-16(14)18/h1-2,5,7,9-10,13,18H,3-4,6,8,11-12,22H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | NZGFHERHNABIOW-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|