C17H15Cl2NO — CID 7428902
3,5-dichloro-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 7428902) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is 3,5-dichloro-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | 3,5-dichloro-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 7428902 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3,5-dichloro-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | O=C(N[C@H]1CCCc2ccccc21)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO/c18-13-8-12(9-14(19)10-13)17(21)20-16-7-3-5-11-4-1-2-6-15(11)16/h1-2,4,6,8-10,16H,3,5,7H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | AAGZLFDVTVXFLL-INIZCTEOSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |