C20H23N3O4 — CID 125172194
1-[[(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl]-3-(4,7-dimethyl-2-oxochromen-6-yl)urea (PubChem CID 125172194) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[[(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl]-3-(4,7-dimethyl-2-oxochromen-6-yl)urea.
| Compound Name | 1-[[(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl]-3-(4,7-dimethyl-2-oxochromen-6-yl)urea |
|---|---|
| PubChem CID | 125172194 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[[(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl]-3-(4,7-dimethyl-2-oxochromen-6-yl)urea |
| SMILES | Cc1cc2oc(=O)cc(C)c2cc1NC(=O)NC[C@@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C20H23N3O4/c1-11-6-19(25)27-17-5-12(2)16(8-15(11)17)22-20(26)21-9-13-7-18(24)23(10-13)14-3-4-14/h5-6,8,13-14H,3-4,7,9-10H2,1-2H3,(H2,21,22,26)/t13-/m0/s1 |
| InChIKey | RPDAMOXHLASGSB-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|