C20H30N6 — CID 125173894
N-[[5-[(2R)-2,6-dimethylhept-5-enyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrimidin-2-amine (PubChem CID 125173894) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[[5-[(2R)-2,6-dimethylhept-5-enyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrimidin-2-amine.
| Compound Name | N-[[5-[(2R)-2,6-dimethylhept-5-enyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 125173894 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | N-[[5-[(2R)-2,6-dimethylhept-5-enyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrimidin-2-amine |
| SMILES | CC(C)=CCC[C@@H](C)CN1CCn2nc(CNc3ncccn3)cc2C1 |
| InChI | InChI=1S/C20H30N6/c1-16(2)6-4-7-17(3)14-25-10-11-26-19(15-25)12-18(24-26)13-23-20-21-8-5-9-22-20/h5-6,8-9,12,17H,4,7,10-11,13-15H2,1-3H3,(H,21,22,23)/t17-/m1/s1 |
| InChIKey | BZMFCHPDJADYDE-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|