C24H28FN3O — CID 125175752
(3R)-1-[3-[[2-(4-fluorophenyl)ethylamino]methyl]-8-methylquinolin-2-yl]piperidin-3-ol (PubChem CID 125175752) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is (3R)-1-[3-[[2-(4-fluorophenyl)ethylamino]methyl]-8-methylquinolin-2-yl]piperidin-3-ol.
| Compound Name | (3R)-1-[3-[[2-(4-fluorophenyl)ethylamino]methyl]-8-methylquinolin-2-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 125175752 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (3R)-1-[3-[[2-(4-fluorophenyl)ethylamino]methyl]-8-methylquinolin-2-yl]piperidin-3-ol |
| SMILES | Cc1cccc2cc(CNCCc3ccc(F)cc3)c(N3CCC[C@@H](O)C3)nc12 |
| InChI | InChI=1S/C24H28FN3O/c1-17-4-2-5-19-14-20(15-26-12-11-18-7-9-21(25)10-8-18)24(27-23(17)19)28-13-3-6-22(29)16-28/h2,4-5,7-10,14,22,26,29H,3,6,11-13,15-16H2,1H3/t22-/m1/s1 |
| InChIKey | KOGJPRBWSUAEAR-JOCHJYFZSA-N |
| XLogP | 3.98 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|