C17H23N3O2 — CID 25282607
(3R)-1-[3-[[(5-methylfuran-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol (PubChem CID 25282607) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3R)-1-[3-[[(5-methylfuran-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol.
| Compound Name | (3R)-1-[3-[[(5-methylfuran-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol |
|---|---|
| PubChem CID | 25282607 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3R)-1-[3-[[(5-methylfuran-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol |
| SMILES | Cc1ccc(CNCc2cccnc2N2CCC[C@@H](O)C2)o1 |
| InChI | InChI=1S/C17H23N3O2/c1-13-6-7-16(22-13)11-18-10-14-4-2-8-19-17(14)20-9-3-5-15(21)12-20/h2,4,6-8,15,18,21H,3,5,9-12H2,1H3/t15-/m1/s1 |
| InChIKey | KNIOLDYLZYJKQJ-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |