C16H20ClN3OS — CID 45196503
1-[3-[[(5-chlorothiophen-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol (PubChem CID 45196503) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 1-[3-[[(5-chlorothiophen-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol.
| Compound Name | 1-[3-[[(5-chlorothiophen-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol |
|---|---|
| PubChem CID | 45196503 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-[3-[[(5-chlorothiophen-2-yl)methylamino]methyl]-2-pyridinyl]piperidin-3-ol |
| SMILES | OC1CCCN(c2ncccc2CNCc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C16H20ClN3OS/c17-15-6-5-14(22-15)10-18-9-12-3-1-7-19-16(12)20-8-2-4-13(21)11-20/h1,3,5-7,13,18,21H,2,4,8-11H2 |
| InChIKey | AYTHQCABVBVJJM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |