C15H16ClN3O3 — CID 125176540
(9aR)-2-[2-(2-chlorophenyl)acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 125176540) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is (9aR)-2-[2-(2-chlorophenyl)acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aR)-2-[2-(2-chlorophenyl)acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 125176540 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (9aR)-2-[2-(2-chlorophenyl)acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1NCC(=O)N2CCN(C(=O)Cc3ccccc3Cl)C[C@H]12 |
| InChI | InChI=1S/C15H16ClN3O3/c16-11-4-2-1-3-10(11)7-13(20)18-5-6-19-12(9-18)15(22)17-8-14(19)21/h1-4,12H,5-9H2,(H,17,22)/t12-/m1/s1 |
| InChIKey | NODLFECLKVEGMP-GFCCVEGCSA-N |
| XLogP | 0.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |