C21H26ClN3O3 — CID 154579301
8-[2-(2-chlorophenyl)acetyl]-2-cyclohexyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 154579301) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 8-[2-(2-chlorophenyl)acetyl]-2-cyclohexyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 8-[2-(2-chlorophenyl)acetyl]-2-cyclohexyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 154579301 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 8-[2-(2-chlorophenyl)acetyl]-2-cyclohexyl-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | O=C(Cc1ccccc1Cl)N1CCCN2C(=O)N(C3CCCCC3)C(=O)C2C1 |
| InChI | InChI=1S/C21H26ClN3O3/c22-17-10-5-4-7-15(17)13-19(26)23-11-6-12-24-18(14-23)20(27)25(21(24)28)16-8-2-1-3-9-16/h4-5,7,10,16,18H,1-3,6,8-9,11-14H2 |
| InChIKey | XXDIRAWOJNFDND-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|