C18H21ClN4O2 — CID 125177887
(3R)-N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 125177887) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is (3R)-N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 125177887 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3R)-N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCN1C[C@H](C(=O)NCCCc2nc3ccc(Cl)cc3[nH]2)CC1=O |
| InChI | InChI=1S/C18H21ClN4O2/c1-2-8-23-11-12(9-17(23)24)18(25)20-7-3-4-16-21-14-6-5-13(19)10-15(14)22-16/h2,5-6,10,12H,1,3-4,7-9,11H2,(H,20,25)(H,21,22)/t12-/m1/s1 |
| InChIKey | WILKQVMCJQDEAY-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|