C14H19Cl3N4O — CID 154909809
N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]azetidine-2-carboxamide;dihydrochloride (PubChem CID 154909809) has the molecular formula C14H19Cl3N4O and a molecular weight of 365.69 g/mol. Its IUPAC name is N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]azetidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]azetidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154909809 |
| Molecular Formula | C14H19Cl3N4O |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[3-(6-chloro-1H-benzimidazol-2-yl)propyl]azetidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCc1nc2ccc(Cl)cc2[nH]1)C1CCN1 |
| InChI | InChI=1S/C14H17ClN4O.2ClH/c15-9-3-4-10-12(8-9)19-13(18-10)2-1-6-17-14(20)11-5-7-16-11;;/h3-4,8,11,16H,1-2,5-7H2,(H,17,20)(H,18,19);2*1H |
| InChIKey | OKNGWRYMZRRXGF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|