C24H33N5O3 — CID 125178458
3-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide (PubChem CID 125178458) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide.
| Compound Name | 3-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
|---|---|
| PubChem CID | 125178458 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 3-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
| SMILES | COc1cc(=O)n2c(c1C(=O)NCCCn1ccnc1)CCN(C[C@H]1CC=CCC1)CC2 |
| InChI | InChI=1S/C24H33N5O3/c1-32-21-16-22(30)29-15-14-27(17-19-6-3-2-4-7-19)12-8-20(29)23(21)24(31)26-9-5-11-28-13-10-25-18-28/h2-3,10,13,16,18-19H,4-9,11-12,14-15,17H2,1H3,(H,26,31)/t19-/m0/s1 |
| InChIKey | XKTDWHDSVWGWEP-IBGZPJMESA-N |
| XLogP | 2.09 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|