C26H33N5O5 — CID 30851754
3-[(2,5-dimethoxyphenyl)methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide (PubChem CID 30851754) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide.
| Compound Name | 3-[(2,5-dimethoxyphenyl)methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
|---|---|
| PubChem CID | 30851754 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 3-[(2,5-dimethoxyphenyl)methyl]-N-(3-imidazol-1-ylpropyl)-9-methoxy-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
| SMILES | COc1ccc(OC)c(CN2CCc3c(C(=O)NCCCn4ccnc4)c(OC)cc(=O)n3CC2)c1 |
| InChI | InChI=1S/C26H33N5O5/c1-34-20-5-6-22(35-2)19(15-20)17-29-11-7-21-25(23(36-3)16-24(32)31(21)14-13-29)26(33)28-8-4-10-30-12-9-27-18-30/h5-6,9,12,15-16,18H,4,7-8,10-11,13-14,17H2,1-3H3,(H,28,33) |
| InChIKey | RJGPGKWCMOZFRM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|