C9H19NS — CID 12517923
3,4-diethyl-2-methylthiomorpholine (PubChem CID 12517923) has the molecular formula C9H19NS and a molecular weight of 173.32 g/mol. Its IUPAC name is 3,4-diethyl-2-methylthiomorpholine.
| Compound Name | 3,4-diethyl-2-methylthiomorpholine |
|---|---|
| PubChem CID | 12517923 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3,4-diethyl-2-methylthiomorpholine |
| SMILES | CCC1C(C)SCCN1CC |
| InChI | InChI=1S/C9H19NS/c1-4-9-8(3)11-7-6-10(9)5-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | XHDSXJMPDGUBDU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |