C15H24N6OS — CID 125179432
1-[(2S)-2-(dimethylamino)-2-(3-methylthiophen-2-yl)ethyl]-3-(1-propyltriazol-4-yl)urea (PubChem CID 125179432) has the molecular formula C15H24N6OS and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-(3-methylthiophen-2-yl)ethyl]-3-(1-propyltriazol-4-yl)urea.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-(3-methylthiophen-2-yl)ethyl]-3-(1-propyltriazol-4-yl)urea |
|---|---|
| PubChem CID | 125179432 |
| Molecular Formula | C15H24N6OS |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-(3-methylthiophen-2-yl)ethyl]-3-(1-propyltriazol-4-yl)urea |
| SMILES | CCCn1cc(NC(=O)NC[C@@H](c2sccc2C)N(C)C)nn1 |
| InChI | InChI=1S/C15H24N6OS/c1-5-7-21-10-13(18-19-21)17-15(22)16-9-12(20(3)4)14-11(2)6-8-23-14/h6,8,10,12H,5,7,9H2,1-4H3,(H2,16,17,22)/t12-/m0/s1 |
| InChIKey | ZEYLLKVITSUTMV-LBPRGKRZSA-N |
| XLogP | 2.48 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |