C16H20N6OS — CID 29002537
2-[4-methyl-3-(5-methylthiophen-2-yl)pyrazol-1-yl]-N-(1-propyltriazol-4-yl)acetamide (PubChem CID 29002537) has the molecular formula C16H20N6OS and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-[4-methyl-3-(5-methylthiophen-2-yl)pyrazol-1-yl]-N-(1-propyltriazol-4-yl)acetamide.
| Compound Name | 2-[4-methyl-3-(5-methylthiophen-2-yl)pyrazol-1-yl]-N-(1-propyltriazol-4-yl)acetamide |
|---|---|
| PubChem CID | 29002537 |
| Molecular Formula | C16H20N6OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[4-methyl-3-(5-methylthiophen-2-yl)pyrazol-1-yl]-N-(1-propyltriazol-4-yl)acetamide |
| SMILES | CCCn1cc(NC(=O)Cn2cc(C)c(-c3ccc(C)s3)n2)nn1 |
| InChI | InChI=1S/C16H20N6OS/c1-4-7-21-9-14(18-20-21)17-15(23)10-22-8-11(2)16(19-22)13-6-5-12(3)24-13/h5-6,8-9H,4,7,10H2,1-3H3,(H,17,23) |
| InChIKey | BZADZHJCJCRTBQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |