C11H12BrNO — CID 125180944
(2R)-2-[(3-bromo-4-methylphenyl)methyl]-3-hydroxypropanenitrile (PubChem CID 125180944) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is (2R)-2-[(3-bromo-4-methylphenyl)methyl]-3-hydroxypropanenitrile.
| Compound Name | (2R)-2-[(3-bromo-4-methylphenyl)methyl]-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 125180944 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | (2R)-2-[(3-bromo-4-methylphenyl)methyl]-3-hydroxypropanenitrile |
| SMILES | Cc1ccc(C[C@H](C#N)CO)cc1Br |
| InChI | InChI=1S/C11H12BrNO/c1-8-2-3-9(5-11(8)12)4-10(6-13)7-14/h2-3,5,10,14H,4,7H2,1H3/t10-/m1/s1 |
| InChIKey | JOGNGGHLBHXUIC-SNVBAGLBSA-N |
| XLogP | 2.43 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |