C13H15ClN2O — CID 125183702
5-chloro-2-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]benzonitrile (PubChem CID 125183702) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 5-chloro-2-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]benzonitrile.
| Compound Name | 5-chloro-2-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 125183702 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 5-chloro-2-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]benzonitrile |
| SMILES | C[C@H]1CCN(c2ccc(Cl)cc2C#N)C[C@H]1O |
| InChI | InChI=1S/C13H15ClN2O/c1-9-4-5-16(8-13(9)17)12-3-2-11(14)6-10(12)7-15/h2-3,6,9,13,17H,4-5,8H2,1H3/t9-,13+/m0/s1 |
| InChIKey | GZNQGGWSQWLGRE-TVQRCGJNSA-N |
| XLogP | 2.42 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |