C13H16ClN3 — CID 63620950
5-chloro-2-(3,4-dimethylpiperazin-1-yl)benzonitrile (PubChem CID 63620950) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is 5-chloro-2-(3,4-dimethylpiperazin-1-yl)benzonitrile.
| Compound Name | 5-chloro-2-(3,4-dimethylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 63620950 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-chloro-2-(3,4-dimethylpiperazin-1-yl)benzonitrile |
| SMILES | CC1CN(c2ccc(Cl)cc2C#N)CCN1C |
| InChI | InChI=1S/C13H16ClN3/c1-10-9-17(6-5-16(10)2)13-4-3-12(14)7-11(13)8-15/h3-4,7,10H,5-6,9H2,1-2H3 |
| InChIKey | CPRZJQQGSIDJPW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |