C17H25FN2O2 — CID 125184776
(5aR,9aR)-8-(3-fluorophenyl)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine (PubChem CID 125184776) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is (5aR,9aR)-8-(3-fluorophenyl)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine.
| Compound Name | (5aR,9aR)-8-(3-fluorophenyl)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
|---|---|
| PubChem CID | 125184776 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (5aR,9aR)-8-(3-fluorophenyl)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
| SMILES | COCCN1CCO[C@H]2CN(c3cccc(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C17H25FN2O2/c1-21-9-7-19-8-10-22-17-13-20(6-5-14(17)12-19)16-4-2-3-15(18)11-16/h2-4,11,14,17H,5-10,12-13H2,1H3/t14-,17+/m1/s1 |
| InChIKey | NMPVEYKURBRXRO-PBHICJAKSA-N |
| XLogP | 2.00 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |